C22H23N3O5S — CID 15994896
N-cyclopentyl-6-[(3-methoxyphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 15994896) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-cyclopentyl-6-[(3-methoxyphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-cyclopentyl-6-[(3-methoxyphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 15994896 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-cyclopentyl-6-[(3-methoxyphenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc3[nH]cc(C(=O)NC4CCCC4)c(=O)c3c2)c1 |
| InChI | InChI=1S/C22H23N3O5S/c1-30-16-8-4-7-15(11-16)25-31(28,29)17-9-10-20-18(12-17)21(26)19(13-23-20)22(27)24-14-5-2-3-6-14/h4,7-14,25H,2-3,5-6H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | ZDUQPWFMIPVGMJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |