C16H17N2O5S- — CID 5061749
6-(cyclohexylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 5061749) has the molecular formula C16H17N2O5S- and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-(cyclohexylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | 6-(cyclohexylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 5061749 |
| Molecular Formula | C16H17N2O5S- |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 6-(cyclohexylsulfamoyl)-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | O=C([O-])c1c[nH]c2ccc(S(=O)(=O)NC3CCCCC3)cc2c1=O |
| InChI | InChI=1S/C16H18N2O5S/c19-15-12-8-11(6-7-14(12)17-9-13(15)16(20)21)24(22,23)18-10-4-2-1-3-5-10/h6-10,18H,1-5H2,(H,17,19)(H,20,21)/p-1 |
| InChIKey | CQEOETLPJLABOL-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |