C13H15N3O4S — CID 134034344
N-cyclopentyl-2,4-dioxo-1H-quinazoline-6-sulfonamide (PubChem CID 134034344) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-cyclopentyl-2,4-dioxo-1H-quinazoline-6-sulfonamide.
| Compound Name | N-cyclopentyl-2,4-dioxo-1H-quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 134034344 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-cyclopentyl-2,4-dioxo-1H-quinazoline-6-sulfonamide |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)NC3CCCC3)ccc2[nH]1 |
| InChI | InChI=1S/C13H15N3O4S/c17-12-10-7-9(5-6-11(10)14-13(18)15-12)21(19,20)16-8-3-1-2-4-8/h5-8,16H,1-4H2,(H2,14,15,17,18) |
| InChIKey | KGYQIBYAXWYWAN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |