C16H20N2O3S — CID 22548526
N-cycloheptyl-2-oxo-1H-quinoline-6-sulfonamide (PubChem CID 22548526) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-cycloheptyl-2-oxo-1H-quinoline-6-sulfonamide.
| Compound Name | N-cycloheptyl-2-oxo-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 22548526 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-cycloheptyl-2-oxo-1H-quinoline-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)NC3CCCCCC3)ccc2[nH]1 |
| InChI | InChI=1S/C16H20N2O3S/c19-16-10-7-12-11-14(8-9-15(12)17-16)22(20,21)18-13-5-3-1-2-4-6-13/h7-11,13,18H,1-6H2,(H,17,19) |
| InChIKey | YVUUZPKPJHZWCM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |