C14H16N2O4S — CID 5115250
N-cyclohexyl-2,3-dioxo-1H-indole-5-sulfonamide (PubChem CID 5115250) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-cyclohexyl-2,3-dioxo-1H-indole-5-sulfonamide.
| Compound Name | N-cyclohexyl-2,3-dioxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 5115250 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-cyclohexyl-2,3-dioxo-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2C1=O |
| InChI | InChI=1S/C14H16N2O4S/c17-13-11-8-10(6-7-12(11)15-14(13)18)21(19,20)16-9-4-2-1-3-5-9/h6-9,16H,1-5H2,(H,15,17,18) |
| InChIKey | VTPAKCGQCUMCNI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|