C15H19N3O4S — CID 46271707
N-cyclopentyl-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 46271707) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-cyclopentyl-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | N-cyclopentyl-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 46271707 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-cyclopentyl-3-methyl-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | CC1C(=O)Nc2ccc(S(=O)(=O)NC3CCCC3)cc2NC1=O |
| InChI | InChI=1S/C15H19N3O4S/c1-9-14(19)16-12-7-6-11(8-13(12)17-15(9)20)23(21,22)18-10-4-2-3-5-10/h6-10,18H,2-5H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | FBYGNEAXKZFWJQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|