C15H20N2O3S — CID 20858702
N-cycloheptyl-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 20858702) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-cycloheptyl-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-cycloheptyl-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20858702 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-cycloheptyl-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)NC3CCCCCC3)ccc2N1 |
| InChI | InChI=1S/C15H20N2O3S/c18-15-10-11-9-13(7-8-14(11)16-15)21(19,20)17-12-5-3-1-2-4-6-12/h7-9,12,17H,1-6,10H2,(H,16,18) |
| InChIKey | GRCPSONAOVFPMV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |