About 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide
2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide (PubChem CID 110756782) has the molecular formula C13H11N3O3S
and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide |
| PubChem CID | 110756782 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)Nc3ccccn3)ccc2N1 |
| InChI | InChI=1S/C13H11N3O3S/c17-13-8-9-7-10(4-5-11(9)15-13)20(18,19)16-12-3-1-2-6-14-12/h1-7H,8H2,(H,14,16)(H,15,17) |
| InChIKey | LONRYEQBPQBJCR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide?
The IUPAC name of 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide (CID 110756782) is 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide.
What is the SMILES notation for 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide?
The canonical SMILES for 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide is O=C1Cc2cc(S(=O)(=O)Nc3ccccn3)ccc2N1.
What is the InChIKey of 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide?
The InChIKey is LONRYEQBPQBJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O3S/c17-13-8-9-7-10(4-5-11(9)15-13)20(18,19)16-12-3-1-2-6-14-12/h1-7H,8H2,(H,14,16)(H,15,17).
What are the key properties of 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide?
2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide has a molecular weight of 289.32 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-pyridin-2-yl-1,3-dihydroindole-5-sulfonamide is sourced from PubChem (CID 110756782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).