C15H14N2O3S — CID 18197715
N-(3-methylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 18197715) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(3-methylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 18197715 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(3-methylphenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C15H14N2O3S/c1-10-3-2-4-12(7-10)17-21(19,20)13-5-6-14-11(8-13)9-15(18)16-14/h2-8,17H,9H2,1H3,(H,16,18) |
| InChIKey | DRLBFBJGYICRGE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |