C14H11Cl2N3O3S — CID 8822885
N-(4-amino-3,5-dichlorophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 8822885) has the molecular formula C14H11Cl2N3O3S and a molecular weight of 372.23 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 8822885 |
| Molecular Formula | C14H11Cl2N3O3S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | Nc1c(Cl)cc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O3S/c15-10-5-8(6-11(16)14(10)17)19-23(21,22)9-1-2-12-7(3-9)4-13(20)18-12/h1-3,5-6,19H,4,17H2,(H,18,20) |
| InChIKey | ZZGWGKSMOULUOH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|