C13H10FN3O3S — CID 110872393
N-(5-fluoro-3-pyridinyl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 110872393) has the molecular formula C13H10FN3O3S and a molecular weight of 307.31 g/mol. Its IUPAC name is N-(5-fluoro-3-pyridinyl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(5-fluoro-3-pyridinyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110872393 |
| Molecular Formula | C13H10FN3O3S |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(5-fluoro-3-pyridinyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)Nc3cncc(F)c3)ccc2N1 |
| InChI | InChI=1S/C13H10FN3O3S/c14-9-5-10(7-15-6-9)17-21(19,20)11-1-2-12-8(3-11)4-13(18)16-12/h1-3,5-7,17H,4H2,(H,16,18) |
| InChIKey | MDSYVOVZGQXGOT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |