C14H11BrN2O3S — CID 8015526
N-(3-bromophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 8015526) has the molecular formula C14H11BrN2O3S and a molecular weight of 367.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(3-bromophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 8015526 |
| Molecular Formula | C14H11BrN2O3S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | N-(3-bromophenyl)-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)Nc3cccc(Br)c3)ccc2N1 |
| InChI | InChI=1S/C14H11BrN2O3S/c15-10-2-1-3-11(8-10)17-21(19,20)12-4-5-13-9(6-12)7-14(18)16-13/h1-6,8,17H,7H2,(H,16,18) |
| InChIKey | GJJNEBLVWFDGGK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |