C14H11FN2O3S — CID 18570748
4-fluoro-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide (PubChem CID 18570748) has the molecular formula C14H11FN2O3S and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-fluoro-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 18570748 |
| Molecular Formula | C14H11FN2O3S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-fluoro-N-(2-oxo-1,3-dihydroindol-5-yl)benzenesulfonamide |
| SMILES | O=C1Cc2cc(NS(=O)(=O)c3ccc(F)cc3)ccc2N1 |
| InChI | InChI=1S/C14H11FN2O3S/c15-10-1-4-12(5-2-10)21(19,20)17-11-3-6-13-9(7-11)8-14(18)16-13/h1-7,17H,8H2,(H,16,18) |
| InChIKey | SJUNESHRPSQNIN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |