C21H19N3O3S — CID 112985929
N-[4-(2-methylanilino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 112985929) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[4-(2-methylanilino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[4-(2-methylanilino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 112985929 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[4-(2-methylanilino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccccc1Nc1ccc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-14-4-2-3-5-19(14)22-16-6-8-17(9-7-16)24-28(26,27)18-10-11-20-15(12-18)13-21(25)23-20/h2-12,22,24H,13H2,1H3,(H,23,25) |
| InChIKey | WJGDDPQBGYEHQU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |