C17H19N3O4S — CID 112981006
N-[4-(2-methoxyethylamino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 112981006) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[4-(2-methoxyethylamino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[4-(2-methoxyethylamino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 112981006 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[4-(2-methoxyethylamino)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | COCCNc1ccc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-24-9-8-18-13-2-4-14(5-3-13)20-25(22,23)15-6-7-16-12(10-15)11-17(21)19-16/h2-7,10,18,20H,8-9,11H2,1H3,(H,19,21) |
| InChIKey | ASDOOGXTZLAKCA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|