C16H18N4O3S — CID 113009145
2-oxo-N-[6-(propylamino)-3-pyridinyl]-1,3-dihydroindole-5-sulfonamide (PubChem CID 113009145) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-oxo-N-[6-(propylamino)-3-pyridinyl]-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 2-oxo-N-[6-(propylamino)-3-pyridinyl]-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 113009145 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-oxo-N-[6-(propylamino)-3-pyridinyl]-1,3-dihydroindole-5-sulfonamide |
| SMILES | CCCNc1ccc(NS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cn1 |
| InChI | InChI=1S/C16H18N4O3S/c1-2-7-17-15-6-3-12(10-18-15)20-24(22,23)13-4-5-14-11(8-13)9-16(21)19-14/h3-6,8,10,20H,2,7,9H2,1H3,(H,17,18)(H,19,21) |
| InChIKey | HAHGCBLXCQKCRK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |