C21H18N2O4S — CID 110604721
N-[2-(2-methylphenoxy)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 110604721) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[2-(2-methylphenoxy)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[2-(2-methylphenoxy)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110604721 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-[2-(2-methylphenoxy)phenyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1ccccc1Oc1ccccc1NS(=O)(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C21H18N2O4S/c1-14-6-2-4-8-19(14)27-20-9-5-3-7-18(20)23-28(25,26)16-10-11-17-15(12-16)13-21(24)22-17/h2-12,23H,13H2,1H3,(H,22,24) |
| InChIKey | XMXCJTROVZUIAQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |