C22H19N3O5S — CID 25325741
N-[2-(3-methylphenoxy)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide (PubChem CID 25325741) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[2-(3-methylphenoxy)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide.
| Compound Name | N-[2-(3-methylphenoxy)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 25325741 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[2-(3-methylphenoxy)phenyl]-2,4-dioxo-1,5-dihydro-1,5-benzodiazepine-7-sulfonamide |
| SMILES | Cc1cccc(Oc2ccccc2NS(=O)(=O)c2ccc3c(c2)NC(=O)CC(=O)N3)c1 |
| InChI | InChI=1S/C22H19N3O5S/c1-14-5-4-6-15(11-14)30-20-8-3-2-7-18(20)25-31(28,29)16-9-10-17-19(12-16)24-22(27)13-21(26)23-17/h2-12,25H,13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | VOKOHIRAVBJSJK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|