C17H15N3O6S — CID 20876182
methyl 2-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-7-yl)sulfonylamino]benzoate (PubChem CID 20876182) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is methyl 2-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-7-yl)sulfonylamino]benzoate.
| Compound Name | methyl 2-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-7-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 20876182 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | methyl 2-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-7-yl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)NC(=O)CC(=O)N2 |
| InChI | InChI=1S/C17H15N3O6S/c1-26-17(23)11-4-2-3-5-12(11)20-27(24,25)10-6-7-13-14(8-10)19-16(22)9-15(21)18-13/h2-8,20H,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | UZUDNMNKHJXLDH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|