C17H17NO4S — CID 4793271
methyl 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)benzoate (PubChem CID 4793271) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)benzoate.
| Compound Name | methyl 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 4793271 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H17NO4S/c1-22-17(19)15-7-2-3-8-16(15)18-23(20,21)14-10-9-12-5-4-6-13(12)11-14/h2-3,7-11,18H,4-6H2,1H3 |
| InChIKey | UERULMDVBIEEDD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |