C18H20N2O4S — CID 47092045
2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N-methoxy-N-methylbenzamide (PubChem CID 47092045) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N-methoxy-N-methylbenzamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 47092045 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H20N2O4S/c1-20(24-2)18(21)16-8-3-4-9-17(16)19-25(22,23)15-11-10-13-6-5-7-14(13)12-15/h3-4,8-12,19H,5-7H2,1-2H3 |
| InChIKey | GQPOMMAPWSXNEB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|