C17H17NO5S — CID 110705670
methyl 2-(3,4-dihydro-2H-chromen-6-ylsulfonylamino)benzoate (PubChem CID 110705670) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-2H-chromen-6-ylsulfonylamino)benzoate.
| Compound Name | methyl 2-(3,4-dihydro-2H-chromen-6-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 110705670 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | methyl 2-(3,4-dihydro-2H-chromen-6-ylsulfonylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C17H17NO5S/c1-22-17(19)14-6-2-3-7-15(14)18-24(20,21)13-8-9-16-12(11-13)5-4-10-23-16/h2-3,6-9,11,18H,4-5,10H2,1H3 |
| InChIKey | CBBJORZVBMMXOS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |