About (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate
(3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (PubChem CID 35516996) has the molecular formula C23H21NO7S
and a molecular weight of 455.49 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| PubChem CID | 35516996 |
| Molecular Formula | C23H21NO7S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| SMILES | COc1cccc(COC(=O)c2ccccc2NS(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C23H21NO7S/c1-28-17-6-4-5-16(13-17)15-31-23(25)19-7-2-3-8-20(19)24-32(26,27)18-9-10-21-22(14-18)30-12-11-29-21/h2-10,13-14,24H,11-12,15H2,1H3 |
| InChIKey | WKOLZNBMUYVJTG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate?
The IUPAC name of (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (CID 35516996) is (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate?
The canonical SMILES for (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate is COc1cccc(COC(=O)c2ccccc2NS(=O)(=O)c2ccc3c(c2)OCCO3)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate?
The InChIKey is WKOLZNBMUYVJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO7S/c1-28-17-6-4-5-16(13-17)15-31-23(25)19-7-2-3-8-20(19)24-32(26,27)18-9-10-21-22(14-18)30-12-11-29-21/h2-10,13-14,24H,11-12,15H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate?
(3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate has a molecular weight of 455.49 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate is sourced from PubChem (CID 35516996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).