C24H22N2O8S — CID 55615577
[3-(ethoxycarbonylamino)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (PubChem CID 55615577) has the molecular formula C24H22N2O8S and a molecular weight of 498.51 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
| Compound Name | [3-(ethoxycarbonylamino)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 55615577 |
| Molecular Formula | C24H22N2O8S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)c2ccccc2NS(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C24H22N2O8S/c1-2-31-24(28)25-16-6-5-7-17(14-16)34-23(27)19-8-3-4-9-20(19)26-35(29,30)18-10-11-21-22(15-18)33-13-12-32-21/h3-11,14-15,26H,2,12-13H2,1H3,(H,25,28) |
| InChIKey | JQHWHZPOONMPER-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|