C23H28N2O8S — CID 55341158
[3-(ethoxycarbonylamino)phenyl] 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanoate (PubChem CID 55341158) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanoate.
| Compound Name | [3-(ethoxycarbonylamino)phenyl] 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 55341158 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanoate |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)C(NS(=O)(=O)c2ccc3c(c2)OCCCO3)C(C)C)c1 |
| InChI | InChI=1S/C23H28N2O8S/c1-4-30-23(27)24-16-7-5-8-17(13-16)33-22(26)21(15(2)3)25-34(28,29)18-9-10-19-20(14-18)32-12-6-11-31-19/h5,7-10,13-15,21,25H,4,6,11-12H2,1-3H3,(H,24,27) |
| InChIKey | LBKWSXTYPQODHX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|