C21H23IN2O7S — CID 2516642
[2-(3-iodoanilino)-2-oxoethyl] (2S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate (PubChem CID 2516642) has the molecular formula C21H23IN2O7S and a molecular weight of 574.39 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] (2S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] (2S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 2516642 |
| Molecular Formula | C21H23IN2O7S |
| Molecular Weight | 574.39 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] (2S)-2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)OCCO2)C(=O)OCC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C21H23IN2O7S/c1-13(2)20(21(26)31-12-19(25)23-15-5-3-4-14(22)10-15)24-32(27,28)16-6-7-17-18(11-16)30-9-8-29-17/h3-7,10-11,13,20,24H,8-9,12H2,1-2H3,(H,23,25)/t20-/m0/s1 |
| InChIKey | QVTNIRDYNAAIKH-FQEVSTJZSA-N |
| XLogP | 2.55 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|