C22H26N2O7S — CID 34320492
[2-oxo-2-(pentylamino)ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (PubChem CID 34320492) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is [2-oxo-2-(pentylamino)ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
| Compound Name | [2-oxo-2-(pentylamino)ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 34320492 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [2-oxo-2-(pentylamino)ethyl] 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| SMILES | CCCCCNC(=O)COC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H26N2O7S/c1-2-3-6-11-23-21(25)15-31-22(26)17-7-4-5-8-18(17)24-32(27,28)16-9-10-19-20(14-16)30-13-12-29-19/h4-5,7-10,14,24H,2-3,6,11-13,15H2,1H3,(H,23,25) |
| InChIKey | BVYWTVODFFDOIO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|