C23H21NO6S — CID 35451662
benzyl 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)benzoate (PubChem CID 35451662) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is benzyl 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)benzoate.
| Compound Name | benzyl 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 35451662 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | benzyl 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(NS(=O)(=O)c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C23H21NO6S/c25-23(30-16-17-5-2-1-3-6-17)18-7-9-19(10-8-18)24-31(26,27)20-11-12-21-22(15-20)29-14-4-13-28-21/h1-3,5-12,15,24H,4,13-14,16H2 |
| InChIKey | MZYUAHACSBIWCX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |