C25H23NO8S — CID 16578421
2-(2-acetylphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (PubChem CID 16578421) has the molecular formula C25H23NO8S and a molecular weight of 497.53 g/mol. Its IUPAC name is 2-(2-acetylphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
| Compound Name | 2-(2-acetylphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 16578421 |
| Molecular Formula | C25H23NO8S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 2-(2-acetylphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| SMILES | CC(=O)c1ccccc1OCCOC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C25H23NO8S/c1-17(27)21-4-2-3-5-22(21)31-14-15-34-25(28)18-6-8-19(9-7-18)26-35(29,30)20-10-11-23-24(16-20)33-13-12-32-23/h2-11,16,26H,12-15H2,1H3 |
| InChIKey | UVMZOOAXTOTDIK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|