C25H20N2O8S — CID 2395225
2-(1,3-dioxoisoindol-2-yl)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (PubChem CID 2395225) has the molecular formula C25H20N2O8S and a molecular weight of 508.51 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 2395225 |
| Molecular Formula | C25H20N2O8S |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C25H20N2O8S/c28-23-19-3-1-2-4-20(19)24(29)27(23)11-12-35-25(30)16-5-7-17(8-6-16)26-36(31,32)18-9-10-21-22(15-18)34-14-13-33-21/h1-10,15,26H,11-14H2 |
| InChIKey | UWPOESHXJBRSMB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|