C15H13F2NO3S — CID 110705681
N-(2,4-difluorophenyl)-3,4-dihydro-2H-chromene-6-sulfonamide (PubChem CID 110705681) has the molecular formula C15H13F2NO3S and a molecular weight of 325.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3,4-dihydro-2H-chromene-6-sulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-3,4-dihydro-2H-chromene-6-sulfonamide |
|---|---|
| PubChem CID | 110705681 |
| Molecular Formula | C15H13F2NO3S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-3,4-dihydro-2H-chromene-6-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1F)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C15H13F2NO3S/c16-11-3-5-14(13(17)9-11)18-22(19,20)12-4-6-15-10(8-12)2-1-7-21-15/h3-6,8-9,18H,1-2,7H2 |
| InChIKey | CRJVRLYNLBHALB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |