C15H14BrNO3S — CID 46807417
N-(4-bromo-2-methylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 46807417) has the molecular formula C15H14BrNO3S and a molecular weight of 368.25 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 46807417 |
| Molecular Formula | C15H14BrNO3S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | Cc1cc(Br)ccc1NS(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H14BrNO3S/c1-10-8-12(16)2-4-14(10)17-21(18,19)13-3-5-15-11(9-13)6-7-20-15/h2-5,8-9,17H,6-7H2,1H3 |
| InChIKey | DEVRIHILYLHHDC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |