C16H17NO3S — CID 44623892
N-(3,4-dimethylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 44623892) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 44623892 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)CCO3)cc1C |
| InChI | InChI=1S/C16H17NO3S/c1-11-3-4-14(9-12(11)2)17-21(18,19)15-5-6-16-13(10-15)7-8-20-16/h3-6,9-10,17H,7-8H2,1-2H3 |
| InChIKey | QZSFYJIYVVPYDL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |