C14H11Cl2NO3S — CID 110344403
N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 110344403) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 110344403 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1Cl)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H11Cl2NO3S/c15-10-1-3-13(12(16)8-10)17-21(18,19)11-2-4-14-9(7-11)5-6-20-14/h1-4,7-8,17H,5-6H2 |
| InChIKey | HTPAEPPPOVVGJR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |