C18H21NO5S — CID 46807478
N-(2,5-diethoxyphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 46807478) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 46807478 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | CCOc1ccc(OCC)c(NS(=O)(=O)c2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C18H21NO5S/c1-3-22-14-5-7-18(23-4-2)16(12-14)19-25(20,21)15-6-8-17-13(11-15)9-10-24-17/h5-8,11-12,19H,3-4,9-10H2,1-2H3 |
| InChIKey | NMVZBPHPRDPHBI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |