C16H18INO4S — CID 3792893
N-(2,5-diethoxyphenyl)-4-iodobenzenesulfonamide (PubChem CID 3792893) has the molecular formula C16H18INO4S and a molecular weight of 447.29 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-4-iodobenzenesulfonamide.
| Compound Name | N-(2,5-diethoxyphenyl)-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 3792893 |
| Molecular Formula | C16H18INO4S |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-4-iodobenzenesulfonamide |
| SMILES | CCOc1ccc(OCC)c(NS(=O)(=O)c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C16H18INO4S/c1-3-21-13-7-10-16(22-4-2)15(11-13)18-23(19,20)14-8-5-12(17)6-9-14/h5-11,18H,3-4H2,1-2H3 |
| InChIKey | BMUVEJFQDPSHMZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|