C17H20INO4S — CID 60597563
3,4-diethoxy-N-(4-iodo-2-methylphenyl)benzenesulfonamide (PubChem CID 60597563) has the molecular formula C17H20INO4S and a molecular weight of 461.32 g/mol. Its IUPAC name is 3,4-diethoxy-N-(4-iodo-2-methylphenyl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(4-iodo-2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60597563 |
| Molecular Formula | C17H20INO4S |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 3,4-diethoxy-N-(4-iodo-2-methylphenyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(I)cc2C)cc1OCC |
| InChI | InChI=1S/C17H20INO4S/c1-4-22-16-9-7-14(11-17(16)23-5-2)24(20,21)19-15-8-6-13(18)10-12(15)3/h6-11,19H,4-5H2,1-3H3 |
| InChIKey | VYDUEFLIARENDT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|