C13H10F2INO2S — CID 3838245
3,4-difluoro-N-(4-iodo-2-methylphenyl)benzenesulfonamide (PubChem CID 3838245) has the molecular formula C13H10F2INO2S and a molecular weight of 409.20 g/mol. Its IUPAC name is 3,4-difluoro-N-(4-iodo-2-methylphenyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(4-iodo-2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3838245 |
| Molecular Formula | C13H10F2INO2S |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 408.94 |
| IUPAC Name | 3,4-difluoro-N-(4-iodo-2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(I)ccc1NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H10F2INO2S/c1-8-6-9(16)2-5-13(8)17-20(18,19)10-3-4-11(14)12(15)7-10/h2-7,17H,1H3 |
| InChIKey | FGDBEEUJECRWMH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|