C14H11F3INO2S — CID 3729383
N-(4-iodo-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 3729383) has the molecular formula C14H11F3INO2S and a molecular weight of 441.21 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3729383 |
| Molecular Formula | C14H11F3INO2S |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 440.95 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1cc(I)ccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3INO2S/c1-9-7-11(18)5-6-13(9)19-22(20,21)12-4-2-3-10(8-12)14(15,16)17/h2-8,19H,1H3 |
| InChIKey | XZUUOHYDFMBOEE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|