C15H16F3N3O4S2 — CID 52838841
N-methyl-4-(methylamino)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzenesulfonamide (PubChem CID 52838841) has the molecular formula C15H16F3N3O4S2 and a molecular weight of 423.44 g/mol. Its IUPAC name is N-methyl-4-(methylamino)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzenesulfonamide.
| Compound Name | N-methyl-4-(methylamino)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 52838841 |
| Molecular Formula | C15H16F3N3O4S2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N-methyl-4-(methylamino)-3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzenesulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)NC)cc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3N3O4S2/c1-19-13-7-6-12(26(22,23)20-2)9-14(13)21-27(24,25)11-5-3-4-10(8-11)15(16,17)18/h3-9,19-21H,1-2H3 |
| InChIKey | JLLSBKKUQLAKJE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |