C20H16ClF3N2O4S2 — CID 175722965
N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 175722965) has the molecular formula C20H16ClF3N2O4S2 and a molecular weight of 504.94 g/mol. Its IUPAC name is N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 175722965 |
| Molecular Formula | C20H16ClF3N2O4S2 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | N-[4-[(3-chloro-2-methylphenyl)sulfamoyl]phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1NS(=O)(=O)c1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H16ClF3N2O4S2/c1-13-18(21)6-3-7-19(13)26-31(27,28)16-10-8-15(9-11-16)25-32(29,30)17-5-2-4-14(12-17)20(22,23)24/h2-12,25-26H,1H3 |
| InChIKey | YDHCXKDJZBMFOM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |