C14H12F3NO3S2 — CID 14536122
N-(2-methylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 14536122) has the molecular formula C14H12F3NO3S2 and a molecular weight of 363.38 g/mol. Its IUPAC name is N-(2-methylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-methylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 14536122 |
| Molecular Formula | C14H12F3NO3S2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | N-(2-methylsulfinylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CS(=O)c1ccccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3NO3S2/c1-22(19)13-8-3-2-7-12(13)18-23(20,21)11-6-4-5-10(9-11)14(15,16)17/h2-9,18H,1H3 |
| InChIKey | SLPXMPFMXBNRIO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |