C16H14F3NO2S2 — CID 14536162
N-(2-prop-2-enylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 14536162) has the molecular formula C16H14F3NO2S2 and a molecular weight of 373.42 g/mol. Its IUPAC name is N-(2-prop-2-enylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-prop-2-enylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 14536162 |
| Molecular Formula | C16H14F3NO2S2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-(2-prop-2-enylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCSc1ccccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO2S2/c1-2-10-23-15-9-4-3-8-14(15)20-24(21,22)13-7-5-6-12(11-13)16(17,18)19/h2-9,11,20H,1,10H2 |
| InChIKey | WCIDWRWQOXXVOC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|