C17H19NO2S2 — CID 8823884
3,4-dimethyl-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide (PubChem CID 8823884) has the molecular formula C17H19NO2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 3,4-dimethyl-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8823884 |
| Molecular Formula | C17H19NO2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3,4-dimethyl-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide |
| SMILES | C=CCSc1ccccc1NS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H19NO2S2/c1-4-11-21-17-8-6-5-7-16(17)18-22(19,20)15-10-9-13(2)14(3)12-15/h4-10,12,18H,1,11H2,2-3H3 |
| InChIKey | JOOPUJYGLSJQFU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|