C16H16BrNO3S2 — CID 8823907
5-bromo-2-methoxy-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide (PubChem CID 8823907) has the molecular formula C16H16BrNO3S2 and a molecular weight of 414.35 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8823907 |
| Molecular Formula | C16H16BrNO3S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 5-bromo-2-methoxy-N-(2-prop-2-enylsulfanylphenyl)benzenesulfonamide |
| SMILES | C=CCSc1ccccc1NS(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C16H16BrNO3S2/c1-3-10-22-15-7-5-4-6-13(15)18-23(19,20)16-11-12(17)8-9-14(16)21-2/h3-9,11,18H,1,10H2,2H3 |
| InChIKey | RSRMXCSDLMQOQK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|