C15H15BrN2O4S — CID 26268702
2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-methylbenzamide (PubChem CID 26268702) has the molecular formula C15H15BrN2O4S and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-methylbenzamide.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 26268702 |
| Molecular Formula | C15H15BrN2O4S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1NS(=O)(=O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H15BrN2O4S/c1-17-15(19)11-5-3-4-6-12(11)18-23(20,21)14-9-10(16)7-8-13(14)22-2/h3-9,18H,1-2H3,(H,17,19) |
| InChIKey | RDCXDEKVAPGWEM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |