C15H14BrNO5S — CID 51114842
2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-5-methylbenzoic acid (PubChem CID 51114842) has the molecular formula C15H14BrNO5S and a molecular weight of 400.25 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-5-methylbenzoic acid.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 51114842 |
| Molecular Formula | C15H14BrNO5S |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)sulfonylamino]-5-methylbenzoic acid |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Nc1ccc(C)cc1C(=O)O |
| InChI | InChI=1S/C15H14BrNO5S/c1-9-3-5-12(11(7-9)15(18)19)17-23(20,21)14-8-10(16)4-6-13(14)22-2/h3-8,17H,1-2H3,(H,18,19) |
| InChIKey | KCZOYJDUKWNRQX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |