C18H20BrNO7S — CID 24580581
2-[(5-bromo-2-methylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid (PubChem CID 24580581) has the molecular formula C18H20BrNO7S and a molecular weight of 474.33 g/mol. Its IUPAC name is 2-[(5-bromo-2-methylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid.
| Compound Name | 2-[(5-bromo-2-methylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 24580581 |
| Molecular Formula | C18H20BrNO7S |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | 2-[(5-bromo-2-methylphenyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(NS(=O)(=O)c2cc(Br)ccc2C)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C18H20BrNO7S/c1-11-4-5-12(19)8-17(11)28(23,24)20-14-10-16(27-7-6-25-2)15(26-3)9-13(14)18(21)22/h4-5,8-10,20H,6-7H2,1-3H3,(H,21,22) |
| InChIKey | UIPAGIZNOVJYEW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|