C16H16Cl2N2O7S — CID 47088946
2-[(2,6-dichloro-3-pyridinyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid (PubChem CID 47088946) has the molecular formula C16H16Cl2N2O7S and a molecular weight of 451.28 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3-pyridinyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid.
| Compound Name | 2-[(2,6-dichloro-3-pyridinyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 47088946 |
| Molecular Formula | C16H16Cl2N2O7S |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 2-[(2,6-dichloro-3-pyridinyl)sulfonylamino]-5-methoxy-4-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(NS(=O)(=O)c2ccc(Cl)nc2Cl)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H16Cl2N2O7S/c1-25-5-6-27-12-8-10(9(16(21)22)7-11(12)26-2)20-28(23,24)13-3-4-14(17)19-15(13)18/h3-4,7-8,20H,5-6H2,1-2H3,(H,21,22) |
| InChIKey | FKRQECVCNQFZLQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|