C19H21ClN2O6 — CID 162752140
5-[2-[4-carboxy-2-methoxy-5-(methylamino)phenoxy]ethyl]-4-chloro-2-(methylamino)benzoic acid (PubChem CID 162752140) has the molecular formula C19H21ClN2O6 and a molecular weight of 408.84 g/mol. Its IUPAC name is 5-[2-[4-carboxy-2-methoxy-5-(methylamino)phenoxy]ethyl]-4-chloro-2-(methylamino)benzoic acid.
| Compound Name | 5-[2-[4-carboxy-2-methoxy-5-(methylamino)phenoxy]ethyl]-4-chloro-2-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 162752140 |
| Molecular Formula | C19H21ClN2O6 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-[2-[4-carboxy-2-methoxy-5-(methylamino)phenoxy]ethyl]-4-chloro-2-(methylamino)benzoic acid |
| SMILES | CNc1cc(Cl)c(CCOc2cc(NC)c(C(=O)O)cc2OC)cc1C(=O)O |
| InChI | InChI=1S/C19H21ClN2O6/c1-21-14-8-13(20)10(6-11(14)18(23)24)4-5-28-17-9-15(22-2)12(19(25)26)7-16(17)27-3/h6-9,21-22H,4-5H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | PYOILLCYQNCKRB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|